C15H18BrNO — CID 116619600
5-bromo-1-[(5,5-dimethyloxolan-2-yl)methyl]indole (PubChem CID 116619600) has the molecular formula C15H18BrNO and a molecular weight of 308.22 g/mol. Its IUPAC name is 5-bromo-1-[(5,5-dimethyloxolan-2-yl)methyl]indole.
| Compound Name | 5-bromo-1-[(5,5-dimethyloxolan-2-yl)methyl]indole |
|---|---|
| PubChem CID | 116619600 |
| Molecular Formula | C15H18BrNO |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 5-bromo-1-[(5,5-dimethyloxolan-2-yl)methyl]indole |
| SMILES | CC1(C)CCC(Cn2ccc3cc(Br)ccc32)O1 |
| InChI | InChI=1S/C15H18BrNO/c1-15(2)7-5-13(18-15)10-17-8-6-11-9-12(16)3-4-14(11)17/h3-4,6,8-9,13H,5,7,10H2,1-2H3 |
| InChIKey | LCWGYXPOWZCFHD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |