C16H20N2OS — CID 107917461
1-[(5,5-dimethyloxolan-2-yl)methyl]indole-6-carbothioamide (PubChem CID 107917461) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-6-carbothioamide.
| Compound Name | 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-6-carbothioamide |
|---|---|
| PubChem CID | 107917461 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-[(5,5-dimethyloxolan-2-yl)methyl]indole-6-carbothioamide |
| SMILES | CC1(C)CCC(Cn2ccc3ccc(C(N)=S)cc32)O1 |
| InChI | InChI=1S/C16H20N2OS/c1-16(2)7-5-13(19-16)10-18-8-6-11-3-4-12(15(17)20)9-14(11)18/h3-4,6,8-9,13H,5,7,10H2,1-2H3,(H2,17,20) |
| InChIKey | IJBGEECPGUORKE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|