C14H18ClNO3 — CID 116523259
(5,5-dimethyloxolan-2-yl)methyl 2-amino-6-chlorobenzoate (PubChem CID 116523259) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is (5,5-dimethyloxolan-2-yl)methyl 2-amino-6-chlorobenzoate.
| Compound Name | (5,5-dimethyloxolan-2-yl)methyl 2-amino-6-chlorobenzoate |
|---|---|
| PubChem CID | 116523259 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (5,5-dimethyloxolan-2-yl)methyl 2-amino-6-chlorobenzoate |
| SMILES | CC1(C)CCC(COC(=O)c2c(N)cccc2Cl)O1 |
| InChI | InChI=1S/C14H18ClNO3/c1-14(2)7-6-9(19-14)8-18-13(17)12-10(15)4-3-5-11(12)16/h3-5,9H,6-8,16H2,1-2H3 |
| InChIKey | PCIJKGQGHZTLOX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|