C12H16O4 — CID 99795689
[(2R)-5,5-dimethyloxolan-2-yl]methyl furan-2-carboxylate (PubChem CID 99795689) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is [(2R)-5,5-dimethyloxolan-2-yl]methyl furan-2-carboxylate.
| Compound Name | [(2R)-5,5-dimethyloxolan-2-yl]methyl furan-2-carboxylate |
|---|---|
| PubChem CID | 99795689 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | [(2R)-5,5-dimethyloxolan-2-yl]methyl furan-2-carboxylate |
| SMILES | CC1(C)CC[C@H](COC(=O)c2ccco2)O1 |
| InChI | InChI=1S/C12H16O4/c1-12(2)6-5-9(16-12)8-15-11(13)10-4-3-7-14-10/h3-4,7,9H,5-6,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | SAICJHWGCVSPDP-SECBINFHSA-N |
| XLogP | 2.39 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |