C15H12Cl2O6 — CID 1183207
[(1R,3R)-2,2-dichloro-3-(furan-2-carbonyloxymethyl)cyclopropyl]methyl furan-2-carboxylate (PubChem CID 1183207) has the molecular formula C15H12Cl2O6 and a molecular weight of 359.16 g/mol. Its IUPAC name is [(1R,3R)-2,2-dichloro-3-(furan-2-carbonyloxymethyl)cyclopropyl]methyl furan-2-carboxylate.
| Compound Name | [(1R,3R)-2,2-dichloro-3-(furan-2-carbonyloxymethyl)cyclopropyl]methyl furan-2-carboxylate |
|---|---|
| PubChem CID | 1183207 |
| Molecular Formula | C15H12Cl2O6 |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | [(1R,3R)-2,2-dichloro-3-(furan-2-carbonyloxymethyl)cyclopropyl]methyl furan-2-carboxylate |
| SMILES | O=C(OC[C@H]1[C@H](COC(=O)c2ccco2)C1(Cl)Cl)c1ccco1 |
| InChI | InChI=1S/C15H12Cl2O6/c16-15(17)9(7-22-13(18)11-3-1-5-20-11)10(15)8-23-14(19)12-4-2-6-21-12/h1-6,9-10H,7-8H2/t9-,10-/m0/s1 |
| InChIKey | ZRHWGGXCTPEQFU-UWVGGRQHSA-N |
| XLogP | 3.31 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|