About piperidin-4-ylmethyl furan-2-carboxylate
piperidin-4-ylmethyl furan-2-carboxylate (PubChem CID 53410145) has the molecular formula C11H15NO3
and a molecular weight of 209.24 g/mol. Its IUPAC name is piperidin-4-ylmethyl furan-2-carboxylate.
Molecular Properties
| Compound Name | piperidin-4-ylmethyl furan-2-carboxylate |
| PubChem CID | 53410145 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | piperidin-4-ylmethyl furan-2-carboxylate |
| SMILES | O=C(OCC1CCNCC1)c1ccco1 |
| InChI | InChI=1S/C11H15NO3/c13-11(10-2-1-7-14-10)15-8-9-3-5-12-6-4-9/h1-2,7,9,12H,3-6,8H2 |
| InChIKey | XQIROVCHMFWIJT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperidin-4-ylmethyl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-ylmethyl furan-2-carboxylate?
The IUPAC name of piperidin-4-ylmethyl furan-2-carboxylate (CID 53410145) is piperidin-4-ylmethyl furan-2-carboxylate.
What is the SMILES notation for piperidin-4-ylmethyl furan-2-carboxylate?
The canonical SMILES for piperidin-4-ylmethyl furan-2-carboxylate is O=C(OCC1CCNCC1)c1ccco1.
What is the InChIKey of piperidin-4-ylmethyl furan-2-carboxylate?
The InChIKey is XQIROVCHMFWIJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c13-11(10-2-1-7-14-10)15-8-9-3-5-12-6-4-9/h1-2,7,9,12H,3-6,8H2.
What are the key properties of piperidin-4-ylmethyl furan-2-carboxylate?
piperidin-4-ylmethyl furan-2-carboxylate has a molecular weight of 209.24 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-ylmethyl furan-2-carboxylate is sourced from PubChem (CID 53410145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).