About cyclopentyl furan-2-carboxylate
cyclopentyl furan-2-carboxylate (PubChem CID 565207) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is cyclopentyl furan-2-carboxylate.
Molecular Properties
| Compound Name | cyclopentyl furan-2-carboxylate |
| PubChem CID | 565207 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | cyclopentyl furan-2-carboxylate |
| SMILES | O=C(OC1CCCC1)c1ccco1 |
| InChI | InChI=1S/C10H12O3/c11-10(9-6-3-7-12-9)13-8-4-1-2-5-8/h3,6-8H,1-2,4-5H2 |
| InChIKey | MEYPYQGGEWNTEF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentyl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl furan-2-carboxylate?
The IUPAC name of cyclopentyl furan-2-carboxylate (CID 565207) is cyclopentyl furan-2-carboxylate.
What is the SMILES notation for cyclopentyl furan-2-carboxylate?
The canonical SMILES for cyclopentyl furan-2-carboxylate is O=C(OC1CCCC1)c1ccco1.
What is the InChIKey of cyclopentyl furan-2-carboxylate?
The InChIKey is MEYPYQGGEWNTEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c11-10(9-6-3-7-12-9)13-8-4-1-2-5-8/h3,6-8H,1-2,4-5H2.
What are the key properties of cyclopentyl furan-2-carboxylate?
cyclopentyl furan-2-carboxylate has a molecular weight of 180.20 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl furan-2-carboxylate is sourced from PubChem (CID 565207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).