C12H10O6 — CID 121014452
1,4-bis(furan-2-yl)-2,3-dihydroxybutane-1,4-dione (PubChem CID 121014452) has the molecular formula C12H10O6 and a molecular weight of 250.21 g/mol. Its IUPAC name is 1,4-bis(furan-2-yl)-2,3-dihydroxybutane-1,4-dione.
| Compound Name | 1,4-bis(furan-2-yl)-2,3-dihydroxybutane-1,4-dione |
|---|---|
| PubChem CID | 121014452 |
| Molecular Formula | C12H10O6 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 1,4-bis(furan-2-yl)-2,3-dihydroxybutane-1,4-dione |
| SMILES | O=C(c1ccco1)C(O)C(O)C(=O)c1ccco1 |
| InChI | InChI=1S/C12H10O6/c13-9(7-3-1-5-17-7)11(15)12(16)10(14)8-4-2-6-18-8/h1-6,11-12,15-16H |
| InChIKey | WKABGMSYQRAOHT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |