C9H14O10S — CID 174479869
1-(furan-2-yl)-2,3,4,5-tetrahydroxypentan-1-one;sulfuric acid (PubChem CID 174479869) has the molecular formula C9H14O10S and a molecular weight of 314.27 g/mol. Its IUPAC name is 1-(furan-2-yl)-2,3,4,5-tetrahydroxypentan-1-one;sulfuric acid.
| Compound Name | 1-(furan-2-yl)-2,3,4,5-tetrahydroxypentan-1-one;sulfuric acid |
|---|---|
| PubChem CID | 174479869 |
| Molecular Formula | C9H14O10S |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 1-(furan-2-yl)-2,3,4,5-tetrahydroxypentan-1-one;sulfuric acid |
| SMILES | O=C(c1ccco1)C(O)C(O)C(O)CO.O=S(=O)(O)O |
| InChI | InChI=1S/C9H12O6.H2O4S/c10-4-5(11)7(12)9(14)8(13)6-2-1-3-15-6;1-5(2,3)4/h1-3,5,7,9-12,14H,4H2;(H2,1,2,3,4) |
| InChIKey | FOTNTAMNKRITBQ-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 185.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|