C13H18O8S — CID 141075119
(2R,3S,4S,5R)-1-benzylsulfonyl-2,3,4,5,6-pentahydroxyhexan-1-one (PubChem CID 141075119) has the molecular formula C13H18O8S and a molecular weight of 334.35 g/mol. Its IUPAC name is (2R,3S,4S,5R)-1-benzylsulfonyl-2,3,4,5,6-pentahydroxyhexan-1-one.
| Compound Name | (2R,3S,4S,5R)-1-benzylsulfonyl-2,3,4,5,6-pentahydroxyhexan-1-one |
|---|---|
| PubChem CID | 141075119 |
| Molecular Formula | C13H18O8S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (2R,3S,4S,5R)-1-benzylsulfonyl-2,3,4,5,6-pentahydroxyhexan-1-one |
| SMILES | O=C([C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C13H18O8S/c14-6-9(15)10(16)11(17)12(18)13(19)22(20,21)7-8-4-2-1-3-5-8/h1-5,9-12,14-18H,6-7H2/t9-,10+,11+,12-/m1/s1 |
| InChIKey | CLBQCTNJXLWEQD-NOOOWODRSA-N |
| XLogP | -2.44 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|