C14H18O6 — CID 174420832
4,5,6,7,8-pentahydroxy-1-phenyloct-1-en-3-one (PubChem CID 174420832) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 4,5,6,7,8-pentahydroxy-1-phenyloct-1-en-3-one.
| Compound Name | 4,5,6,7,8-pentahydroxy-1-phenyloct-1-en-3-one |
|---|---|
| PubChem CID | 174420832 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4,5,6,7,8-pentahydroxy-1-phenyloct-1-en-3-one |
| SMILES | O=C(C=Cc1ccccc1)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C14H18O6/c15-8-11(17)13(19)14(20)12(18)10(16)7-6-9-4-2-1-3-5-9/h1-7,11-15,17-20H,8H2 |
| InChIKey | TVDCNGYBJXPHMA-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|