C14H18O2 — CID 100976642
(E,4S)-4-hydroxy-1-phenyloct-1-en-3-one (PubChem CID 100976642) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (E,4S)-4-hydroxy-1-phenyloct-1-en-3-one.
| Compound Name | (E,4S)-4-hydroxy-1-phenyloct-1-en-3-one |
|---|---|
| PubChem CID | 100976642 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (E,4S)-4-hydroxy-1-phenyloct-1-en-3-one |
| SMILES | CCCC[C@H](O)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H18O2/c1-2-3-9-13(15)14(16)11-10-12-7-5-4-6-8-12/h4-8,10-11,13,15H,2-3,9H2,1H3/b11-10+/t13-/m0/s1 |
| InChIKey | XDRLRDSPPYEERE-NHAQELONSA-N |
| XLogP | 2.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|