C17H26ClNO — CID 6515068
(E)-4-[(dimethylamino)methyl]-1-phenyloct-1-en-3-one;hydrochloride (PubChem CID 6515068) has the molecular formula C17H26ClNO and a molecular weight of 295.85 g/mol. Its IUPAC name is (E)-4-[(dimethylamino)methyl]-1-phenyloct-1-en-3-one;hydrochloride.
| Compound Name | (E)-4-[(dimethylamino)methyl]-1-phenyloct-1-en-3-one;hydrochloride |
|---|---|
| PubChem CID | 6515068 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (E)-4-[(dimethylamino)methyl]-1-phenyloct-1-en-3-one;hydrochloride |
| SMILES | CCCCC(CN(C)C)C(=O)/C=C/c1ccccc1.Cl |
| InChI | InChI=1S/C17H25NO.ClH/c1-4-5-11-16(14-18(2)3)17(19)13-12-15-9-7-6-8-10-15;/h6-10,12-13,16H,4-5,11,14H2,1-3H3;1H/b13-12+; |
| InChIKey | YCHQVDPOVIDTTB-UEIGIMKUSA-N |
| XLogP | 4.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|