C19H30INO — CID 44655272
trimethyl-[2-[(E)-3-phenylprop-2-enoyl]heptyl]azanium iodide (PubChem CID 44655272) has the molecular formula C19H30INO and a molecular weight of 415.36 g/mol. Its IUPAC name is trimethyl-[2-[(E)-3-phenylprop-2-enoyl]heptyl]azanium iodide.
| Compound Name | trimethyl-[2-[(E)-3-phenylprop-2-enoyl]heptyl]azanium iodide |
|---|---|
| PubChem CID | 44655272 |
| Molecular Formula | C19H30INO |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | trimethyl-[2-[(E)-3-phenylprop-2-enoyl]heptyl]azanium iodide |
| SMILES | CCCCCC(C[N+](C)(C)C)C(=O)/C=C/c1ccccc1.[I-] |
| InChI | InChI=1S/C19H30NO.HI/c1-5-6-8-13-18(16-20(2,3)4)19(21)15-14-17-11-9-7-10-12-17;/h7,9-12,14-15,18H,5-6,8,13,16H2,1-4H3;1H/q+1;/p-1/b15-14+; |
| InChIKey | DIVHWQLDWZPWRL-WPDLWGESSA-M |
| XLogP | 1.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|