About octan-3-yl 3-phenylprop-2-eneperoxoate
octan-3-yl 3-phenylprop-2-eneperoxoate (PubChem CID 175064819) has the molecular formula C17H24O3
and a molecular weight of 276.38 g/mol. Its IUPAC name is octan-3-yl 3-phenylprop-2-eneperoxoate.
Molecular Properties
| Compound Name | octan-3-yl 3-phenylprop-2-eneperoxoate |
| PubChem CID | 175064819 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | octan-3-yl 3-phenylprop-2-eneperoxoate |
| SMILES | CCCCCC(CC)OOC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C17H24O3/c1-3-5-7-12-16(4-2)19-20-17(18)14-13-15-10-8-6-9-11-15/h6,8-11,13-14,16H,3-5,7,12H2,1-2H3 |
| InChIKey | AESLEGPMCREOPG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze octan-3-yl 3-phenylprop-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-3-yl 3-phenylprop-2-eneperoxoate?
The IUPAC name of octan-3-yl 3-phenylprop-2-eneperoxoate (CID 175064819) is octan-3-yl 3-phenylprop-2-eneperoxoate.
What is the SMILES notation for octan-3-yl 3-phenylprop-2-eneperoxoate?
The canonical SMILES for octan-3-yl 3-phenylprop-2-eneperoxoate is CCCCCC(CC)OOC(=O)C=Cc1ccccc1.
What is the InChIKey of octan-3-yl 3-phenylprop-2-eneperoxoate?
The InChIKey is AESLEGPMCREOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O3/c1-3-5-7-12-16(4-2)19-20-17(18)14-13-15-10-8-6-9-11-15/h6,8-11,13-14,16H,3-5,7,12H2,1-2H3.
What are the key properties of octan-3-yl 3-phenylprop-2-eneperoxoate?
octan-3-yl 3-phenylprop-2-eneperoxoate has a molecular weight of 276.38 g/mol, XLogP of 4.53, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octan-3-yl 3-phenylprop-2-eneperoxoate is sourced from PubChem (CID 175064819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).