About azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide
azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide (PubChem CID 161196227) has the molecular formula C18H31NO4
and a molecular weight of 325.45 g/mol. Its IUPAC name is azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide.
Molecular Properties
| Compound Name | azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide |
| PubChem CID | 161196227 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide |
| SMILES | CCCCCC(CC)OC(=O)C=Cc1ccc(OC)cc1.[NH4+].[OH-] |
| InChI | InChI=1S/C18H26O3.H3N.H2O/c1-4-6-7-8-16(5-2)21-18(19)14-11-15-9-12-17(20-3)13-10-15;;/h9-14,16H,4-8H2,1-3H3;1H3;1H2 |
| InChIKey | UUJJRVARGNHCEL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide?
The IUPAC name of azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide (CID 161196227) is azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide.
What is the SMILES notation for azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide?
The canonical SMILES for azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide is CCCCCC(CC)OC(=O)C=Cc1ccc(OC)cc1.[NH4+].[OH-].
What is the InChIKey of azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide?
The InChIKey is UUJJRVARGNHCEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O3.H3N.H2O/c1-4-6-7-8-16(5-2)21-18(19)14-11-15-9-12-17(20-3)13-10-15;;/h9-14,16H,4-8H2,1-3H3;1H3;1H2.
What are the key properties of azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide?
azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide has a molecular weight of 325.45 g/mol, XLogP of 4.81, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;octan-3-yl 3-(4-methoxyphenyl)prop-2-enoate;hydroxide is sourced from PubChem (CID 161196227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).