C36H52O6 — CID 66680785
2-ethylhexyl (E)-3-(4-methoxyphenyl)prop-2-enoate;octan-3-yl (E)-3-(2-methoxyphenyl)prop-2-enoate (PubChem CID 66680785) has the molecular formula C36H52O6 and a molecular weight of 580.81 g/mol. Its IUPAC name is 2-ethylhexyl (E)-3-(4-methoxyphenyl)prop-2-enoate;octan-3-yl (E)-3-(2-methoxyphenyl)prop-2-enoate.
| Compound Name | 2-ethylhexyl (E)-3-(4-methoxyphenyl)prop-2-enoate;octan-3-yl (E)-3-(2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 66680785 |
| Molecular Formula | C36H52O6 |
| Molecular Weight | 580.81 g/mol |
| Exact Mass | 580.38 |
| IUPAC Name | 2-ethylhexyl (E)-3-(4-methoxyphenyl)prop-2-enoate;octan-3-yl (E)-3-(2-methoxyphenyl)prop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)/C=C/c1ccc(OC)cc1.CCCCCC(CC)OC(=O)/C=C/c1ccccc1OC |
| InChI | InChI=1S/2C18H26O3/c1-4-6-7-15(5-2)14-21-18(19)13-10-16-8-11-17(20-3)12-9-16;1-4-6-7-11-16(5-2)21-18(19)14-13-15-10-8-9-12-17(15)20-3/h8-13,15H,4-7,14H2,1-3H3;8-10,12-14,16H,4-7,11H2,1-3H3/b13-10+;14-13+ |
| InChIKey | UECUTFQUMVLOGN-OZKZRIMLSA-N |
| XLogP | 9.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.81 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|