C43H58O9 — CID 159959578
2-ethylhexyl 2-hydroxybenzoate;2-ethylhexyl 3-(4-methoxyphenyl)prop-2-enoate;3-(4-methoxyphenyl)prop-2-enoic acid (PubChem CID 159959578) has the molecular formula C43H58O9 and a molecular weight of 718.93 g/mol. Its IUPAC name is 2-ethylhexyl 2-hydroxybenzoate;2-ethylhexyl 3-(4-methoxyphenyl)prop-2-enoate;3-(4-methoxyphenyl)prop-2-enoic acid.
| Compound Name | 2-ethylhexyl 2-hydroxybenzoate;2-ethylhexyl 3-(4-methoxyphenyl)prop-2-enoate;3-(4-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 159959578 |
| Molecular Formula | C43H58O9 |
| Molecular Weight | 718.93 g/mol |
| Exact Mass | 718.41 |
| IUPAC Name | 2-ethylhexyl 2-hydroxybenzoate;2-ethylhexyl 3-(4-methoxyphenyl)prop-2-enoate;3-(4-methoxyphenyl)prop-2-enoic acid |
| SMILES | CCCCC(CC)COC(=O)C=Cc1ccc(OC)cc1.CCCCC(CC)COC(=O)c1ccccc1O.COc1ccc(C=CC(=O)O)cc1 |
| InChI | InChI=1S/C18H26O3.C15H22O3.C10H10O3/c1-4-6-7-15(5-2)14-21-18(19)13-10-16-8-11-17(20-3)12-9-16;1-3-5-8-12(4-2)11-18-15(17)13-9-6-7-10-14(13)16;1-13-9-5-2-8(3-6-9)4-7-10(11)12/h8-13,15H,4-7,14H2,1-3H3;6-7,9-10,12,16H,3-5,8,11H2,1-2H3;2-7H,1H3,(H,11,12) |
| InChIKey | ODDQWKMXBZKTOP-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.93 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|