About [(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate
[(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate (PubChem CID 92533035) has the molecular formula C22H34O3
and a molecular weight of 346.51 g/mol. Its IUPAC name is [(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | [(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate |
| PubChem CID | 92533035 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate |
| SMILES | CCCC[C@H](CC)COC(=O)/C=C\c1ccc(OCCC(C)C)cc1 |
| InChI | InChI=1S/C22H34O3/c1-5-7-8-19(6-2)17-25-22(23)14-11-20-9-12-21(13-10-20)24-16-15-18(3)4/h9-14,18-19H,5-8,15-17H2,1-4H3/b14-11-/t19-/m0/s1 |
| InChIKey | IFOXCRJNHMWYCU-RNUYOQPASA-N |
| XLogP | 5.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate?
The IUPAC name of [(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate (CID 92533035) is [(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate.
What is the SMILES notation for [(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate?
The canonical SMILES for [(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate is CCCC[C@H](CC)COC(=O)/C=C\c1ccc(OCCC(C)C)cc1.
What is the InChIKey of [(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate?
The InChIKey is IFOXCRJNHMWYCU-RNUYOQPASA-N. The full InChI is InChI=1S/C22H34O3/c1-5-7-8-19(6-2)17-25-22(23)14-11-20-9-12-21(13-10-20)24-16-15-18(3)4/h9-14,18-19H,5-8,15-17H2,1-4H3/b14-11-/t19-/m0/s1.
What are the key properties of [(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate?
[(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate has a molecular weight of 346.51 g/mol, XLogP of 5.88, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-ethylhexyl] (Z)-3-[4-(3-methylbutoxy)phenyl]prop-2-enoate is sourced from PubChem (CID 92533035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).