About 2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate
2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate (PubChem CID 143965762) has the molecular formula C19H25IO3
and a molecular weight of 428.31 g/mol. Its IUPAC name is 2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | 2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate |
| PubChem CID | 143965762 |
| Molecular Formula | C19H25IO3 |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)/C=C/c1ccc(O/C=C/I)cc1 |
| InChI | InChI=1S/C19H25IO3/c1-3-5-6-16(4-2)15-23-19(21)12-9-17-7-10-18(11-8-17)22-14-13-20/h7-14,16H,3-6,15H2,1-2H3/b12-9+,14-13+ |
| InChIKey | FHDCANBEMGFUMT-KAQIVPQOSA-N |
| XLogP | 5.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate?
The IUPAC name of 2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate (CID 143965762) is 2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate.
What is the SMILES notation for 2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate?
The canonical SMILES for 2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate is CCCCC(CC)COC(=O)/C=C/c1ccc(O/C=C/I)cc1.
What is the InChIKey of 2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate?
The InChIKey is FHDCANBEMGFUMT-KAQIVPQOSA-N. The full InChI is InChI=1S/C19H25IO3/c1-3-5-6-16(4-2)15-23-19(21)12-9-17-7-10-18(11-8-17)22-14-13-20/h7-14,16H,3-6,15H2,1-2H3/b12-9+,14-13+.
What are the key properties of 2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate?
2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate has a molecular weight of 428.31 g/mol, XLogP of 5.74, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl (E)-3-[4-[(E)-2-iodoethenoxy]phenyl]prop-2-enoate is sourced from PubChem (CID 143965762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).