C31H36O4 — CID 67021609
diphenylmethanone;2-ethylhexyl 3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 67021609) has the molecular formula C31H36O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is diphenylmethanone;2-ethylhexyl 3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | diphenylmethanone;2-ethylhexyl 3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 67021609 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | diphenylmethanone;2-ethylhexyl 3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)C=Cc1ccc(OC)cc1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H26O3.C13H10O/c1-4-6-7-15(5-2)14-21-18(19)13-10-16-8-11-17(20-3)12-9-16;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h8-13,15H,4-7,14H2,1-3H3;1-10H |
| InChIKey | XBZAXQPTMXONBR-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|