C36H52O6 — CID 66716155
5-ethyl-2-methoxy-3-phenylnon-2-enoic acid;octyl 3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 66716155) has the molecular formula C36H52O6 and a molecular weight of 580.81 g/mol. Its IUPAC name is 5-ethyl-2-methoxy-3-phenylnon-2-enoic acid;octyl 3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | 5-ethyl-2-methoxy-3-phenylnon-2-enoic acid;octyl 3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 66716155 |
| Molecular Formula | C36H52O6 |
| Molecular Weight | 580.81 g/mol |
| Exact Mass | 580.38 |
| IUPAC Name | 5-ethyl-2-methoxy-3-phenylnon-2-enoic acid;octyl 3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | CCCCC(CC)CC(=C(OC)C(=O)O)c1ccccc1.CCCCCCCCOC(=O)C=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/2C18H26O3/c1-4-6-10-14(5-2)13-16(17(21-3)18(19)20)15-11-8-7-9-12-15;1-3-4-5-6-7-8-15-21-18(19)14-11-16-9-12-17(20-2)13-10-16/h7-9,11-12,14H,4-6,10,13H2,1-3H3,(H,19,20);9-14H,3-8,15H2,1-2H3 |
| InChIKey | GYGORJKTHVAAOX-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.81 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|