C33H48O6 — CID 70120695
4-ethyl-2-[(4-methoxyphenyl)methylidene]octanoic acid;octyl 2-hydroxybenzoate (PubChem CID 70120695) has the molecular formula C33H48O6 and a molecular weight of 540.74 g/mol. Its IUPAC name is 4-ethyl-2-[(4-methoxyphenyl)methylidene]octanoic acid;octyl 2-hydroxybenzoate.
| Compound Name | 4-ethyl-2-[(4-methoxyphenyl)methylidene]octanoic acid;octyl 2-hydroxybenzoate |
|---|---|
| PubChem CID | 70120695 |
| Molecular Formula | C33H48O6 |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | 4-ethyl-2-[(4-methoxyphenyl)methylidene]octanoic acid;octyl 2-hydroxybenzoate |
| SMILES | CCCCC(CC)CC(=Cc1ccc(OC)cc1)C(=O)O.CCCCCCCCOC(=O)c1ccccc1O |
| InChI | InChI=1S/C18H26O3.C15H22O3/c1-4-6-7-14(5-2)12-16(18(19)20)13-15-8-10-17(21-3)11-9-15;1-2-3-4-5-6-9-12-18-15(17)13-10-7-8-11-14(13)16/h8-11,13-14H,4-7,12H2,1-3H3,(H,19,20);7-8,10-11,16H,2-6,9,12H2,1H3 |
| InChIKey | JJPUYLFLMGUGRZ-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|