C38H45NO6 — CID 174862857
2-ethoxyethyl (E)-3-(4-methoxyphenyl)prop-2-enoate;2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate (PubChem CID 174862857) has the molecular formula C38H45NO6 and a molecular weight of 611.78 g/mol. Its IUPAC name is 2-ethoxyethyl (E)-3-(4-methoxyphenyl)prop-2-enoate;2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate.
| Compound Name | 2-ethoxyethyl (E)-3-(4-methoxyphenyl)prop-2-enoate;2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 174862857 |
| Molecular Formula | C38H45NO6 |
| Molecular Weight | 611.78 g/mol |
| Exact Mass | 611.32 |
| IUPAC Name | 2-ethoxyethyl (E)-3-(4-methoxyphenyl)prop-2-enoate;2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)C(C#N)=C(c1ccccc1)c1ccccc1.CCOCCOC(=O)/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H27NO2.C14H18O4/c1-3-5-12-19(4-2)18-27-24(26)22(17-25)23(20-13-8-6-9-14-20)21-15-10-7-11-16-21;1-3-17-10-11-18-14(15)9-6-12-4-7-13(16-2)8-5-12/h6-11,13-16,19H,3-5,12,18H2,1-2H3;4-9H,3,10-11H2,1-2H3/b;9-6+ |
| InChIKey | JNRFOBVRNSRTEH-RRJFPGPQSA-N |
| XLogP | 8.06 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.78 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|