C39H56O6 — CID 10985001
2-ethylhexyl (E)-3-[4-[5-[4-[(E)-3-(2-ethylhexoxy)-3-oxoprop-1-enyl]phenoxy]pentoxy]phenyl]prop-2-enoate (PubChem CID 10985001) has the molecular formula C39H56O6 and a molecular weight of 620.87 g/mol. Its IUPAC name is 2-ethylhexyl (E)-3-[4-[5-[4-[(E)-3-(2-ethylhexoxy)-3-oxoprop-1-enyl]phenoxy]pentoxy]phenyl]prop-2-enoate.
| Compound Name | 2-ethylhexyl (E)-3-[4-[5-[4-[(E)-3-(2-ethylhexoxy)-3-oxoprop-1-enyl]phenoxy]pentoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 10985001 |
| Molecular Formula | C39H56O6 |
| Molecular Weight | 620.87 g/mol |
| Exact Mass | 620.41 |
| IUPAC Name | 2-ethylhexyl (E)-3-[4-[5-[4-[(E)-3-(2-ethylhexoxy)-3-oxoprop-1-enyl]phenoxy]pentoxy]phenyl]prop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)/C=C/c1ccc(OCCCCCOc2ccc(/C=C/C(=O)OCC(CC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C39H56O6/c1-5-9-14-32(7-3)30-44-38(40)26-20-34-16-22-36(23-17-34)42-28-12-11-13-29-43-37-24-18-35(19-25-37)21-27-39(41)45-31-33(8-4)15-10-6-2/h16-27,32-33H,5-15,28-31H2,1-4H3/b26-20+,27-21+ |
| InChIKey | OAHLWPDATYPDHY-CRYYDKFDSA-N |
| XLogP | 9.86 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.87 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|