C24H34O5 — CID 67981142
[2-ethyl-8-[4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]octyl] 2-methylprop-2-enoate (PubChem CID 67981142) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [2-ethyl-8-[4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]octyl] 2-methylprop-2-enoate.
| Compound Name | [2-ethyl-8-[4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]octyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67981142 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [2-ethyl-8-[4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]octyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CC)CCCCCCOc1ccc(C=CC(=O)OC)cc1 |
| InChI | InChI=1S/C24H34O5/c1-5-20(18-29-24(26)19(2)3)10-8-6-7-9-17-28-22-14-11-21(12-15-22)13-16-23(25)27-4/h11-16,20H,2,5-10,17-18H2,1,3-4H3 |
| InChIKey | WETZKOYYZZLWEK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|