C32H50O5 — CID 67981518
[3-ethyl-2-[6-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]hexyl]decyl] 2-methylprop-2-enoate (PubChem CID 67981518) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is [3-ethyl-2-[6-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]hexyl]decyl] 2-methylprop-2-enoate.
| Compound Name | [3-ethyl-2-[6-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]hexyl]decyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67981518 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | [3-ethyl-2-[6-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]hexyl]decyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCCCCCOc1ccc(/C=C/C(=O)OC)cc1)C(CC)CCCCCCC |
| InChI | InChI=1S/C32H50O5/c1-6-8-9-10-13-16-28(7-2)29(25-37-32(34)26(3)4)17-14-11-12-15-24-36-30-21-18-27(19-22-30)20-23-31(33)35-5/h18-23,28-29H,3,6-17,24-25H2,1-2,4-5H3/b23-20+ |
| InChIKey | LDTJCQPATBJFOY-BSYVCWPDSA-N |
| XLogP | 8.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|