C30H46O5 — CID 67981815
3-[5-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]pentyl]undecyl 2-methylprop-2-enoate (PubChem CID 67981815) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is 3-[5-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]pentyl]undecyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]pentyl]undecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67981815 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | 3-[5-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]pentyl]undecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(CCCCCCCC)CCCCCOc1ccc(/C=C/C(=O)OC)cc1 |
| InChI | InChI=1S/C30H46O5/c1-5-6-7-8-9-11-14-26(22-24-35-30(32)25(2)3)15-12-10-13-23-34-28-19-16-27(17-20-28)18-21-29(31)33-4/h16-21,26H,2,5-15,22-24H2,1,3-4H3/b21-18+ |
| InChIKey | HLGNUMFQFWLNIL-DYTRJAOYSA-N |
| XLogP | 7.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|