C31H38O7 — CID 162076203
6-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]hexyl 2-methylprop-2-enoate;(4-methylphenyl) 2-methylprop-2-enoate (PubChem CID 162076203) has the molecular formula C31H38O7 and a molecular weight of 522.64 g/mol. Its IUPAC name is 6-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]hexyl 2-methylprop-2-enoate;(4-methylphenyl) 2-methylprop-2-enoate.
| Compound Name | 6-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]hexyl 2-methylprop-2-enoate;(4-methylphenyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162076203 |
| Molecular Formula | C31H38O7 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 6-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]hexyl 2-methylprop-2-enoate;(4-methylphenyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(/C=C/C(=O)OC)cc1.C=C(C)C(=O)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C20H26O5.C11H12O2/c1-16(2)20(22)25-15-7-5-4-6-14-24-18-11-8-17(9-12-18)10-13-19(21)23-3;1-8(2)11(12)13-10-6-4-9(3)5-7-10/h8-13H,1,4-7,14-15H2,2-3H3;4-7H,1H2,2-3H3/b13-10+; |
| InChIKey | ZBSSVHNHWSZEJI-RSGUCCNWSA-N |
| XLogP | 6.41 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|