C40H50O6 — CID 101433036
6-[4-[4-[9-[(E)-3-phenylprop-2-enoyl]oxynonoxy]phenyl]phenoxy]hexyl 2-methylprop-2-enoate (PubChem CID 101433036) has the molecular formula C40H50O6 and a molecular weight of 626.83 g/mol. Its IUPAC name is 6-[4-[4-[9-[(E)-3-phenylprop-2-enoyl]oxynonoxy]phenyl]phenoxy]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[4-[4-[9-[(E)-3-phenylprop-2-enoyl]oxynonoxy]phenyl]phenoxy]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 101433036 |
| Molecular Formula | C40H50O6 |
| Molecular Weight | 626.83 g/mol |
| Exact Mass | 626.36 |
| IUPAC Name | 6-[4-[4-[9-[(E)-3-phenylprop-2-enoyl]oxynonoxy]phenyl]phenoxy]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc(-c2ccc(OCCCCCCCCCOC(=O)/C=C/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C40H50O6/c1-33(2)40(42)46-32-16-9-8-14-30-44-38-26-22-36(23-27-38)35-20-24-37(25-21-35)43-29-13-6-4-3-5-7-15-31-45-39(41)28-19-34-17-11-10-12-18-34/h10-12,17-28H,1,3-9,13-16,29-32H2,2H3/b28-19+ |
| InChIKey | VQBFVDNCHMJFRC-TURZUDJPSA-N |
| XLogP | 9.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.83 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|