C29H28O5 — CID 102003786
2-[4-[4-[2-[(E)-3-phenylprop-2-enoyl]oxyethoxy]phenyl]phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 102003786) has the molecular formula C29H28O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-[4-[4-[2-[(E)-3-phenylprop-2-enoyl]oxyethoxy]phenyl]phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[4-[2-[(E)-3-phenylprop-2-enoyl]oxyethoxy]phenyl]phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102003786 |
| Molecular Formula | C29H28O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 2-[4-[4-[2-[(E)-3-phenylprop-2-enoyl]oxyethoxy]phenyl]phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1ccc(-c2ccc(OCCOC(=O)/C=C/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H28O5/c1-22(2)29(31)34-19-18-24-8-11-25(12-9-24)26-13-15-27(16-14-26)32-20-21-33-28(30)17-10-23-6-4-3-5-7-23/h3-17H,1,18-21H2,2H3/b17-10+ |
| InChIKey | IXPUFLOSAZTGKO-LICLKQGHSA-N |
| XLogP | 5.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|