C42H53NO5 — CID 67109876
2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate;2-ethylhexyl (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 67109876) has the molecular formula C42H53NO5 and a molecular weight of 651.89 g/mol. Its IUPAC name is 2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate;2-ethylhexyl (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | 2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate;2-ethylhexyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 67109876 |
| Molecular Formula | C42H53NO5 |
| Molecular Weight | 651.89 g/mol |
| Exact Mass | 651.39 |
| IUPAC Name | 2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate;2-ethylhexyl (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)/C=C/c1ccc(OC)cc1.CCCCC(CC)COC(=O)C(C#N)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27NO2.C18H26O3/c1-3-5-12-19(4-2)18-27-24(26)22(17-25)23(20-13-8-6-9-14-20)21-15-10-7-11-16-21;1-4-6-7-15(5-2)14-21-18(19)13-10-16-8-11-17(20-3)12-9-16/h6-11,13-16,19H,3-5,12,18H2,1-2H3;8-13,15H,4-7,14H2,1-3H3/b;13-10+ |
| InChIKey | PUXMBQLKMOJSTI-TWFHGLTGSA-N |
| XLogP | 10.24 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.89 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|