C26H30BrNO3 — CID 134497655
2-ethylhexyl (Z)-3-[4-(2-bromoethoxy)phenyl]-2-cyano-3-phenylprop-2-enoate (PubChem CID 134497655) has the molecular formula C26H30BrNO3 and a molecular weight of 484.43 g/mol. Its IUPAC name is 2-ethylhexyl (Z)-3-[4-(2-bromoethoxy)phenyl]-2-cyano-3-phenylprop-2-enoate.
| Compound Name | 2-ethylhexyl (Z)-3-[4-(2-bromoethoxy)phenyl]-2-cyano-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 134497655 |
| Molecular Formula | C26H30BrNO3 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 2-ethylhexyl (Z)-3-[4-(2-bromoethoxy)phenyl]-2-cyano-3-phenylprop-2-enoate |
| SMILES | CCCCC(CC)COC(=O)/C(C#N)=C(/c1ccccc1)c1ccc(OCCBr)cc1 |
| InChI | InChI=1S/C26H30BrNO3/c1-3-5-9-20(4-2)19-31-26(29)24(18-28)25(21-10-7-6-8-11-21)22-12-14-23(15-13-22)30-17-16-27/h6-8,10-15,20H,3-5,9,16-17,19H2,1-2H3/b25-24- |
| InChIKey | XFOCMAONFOHQDR-IZHYLOQSSA-N |
| XLogP | 6.55 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|