C37H37N3O5S — CID 87069226
2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate;1-phenylbenzimidazole-2-sulfonic acid (PubChem CID 87069226) has the molecular formula C37H37N3O5S and a molecular weight of 635.79 g/mol. Its IUPAC name is 2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate;1-phenylbenzimidazole-2-sulfonic acid.
| Compound Name | 2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate;1-phenylbenzimidazole-2-sulfonic acid |
|---|---|
| PubChem CID | 87069226 |
| Molecular Formula | C37H37N3O5S |
| Molecular Weight | 635.79 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | 2-ethylhexyl 2-cyano-3,3-diphenylprop-2-enoate;1-phenylbenzimidazole-2-sulfonic acid |
| SMILES | CCCCC(CC)COC(=O)C(C#N)=C(c1ccccc1)c1ccccc1.O=S(=O)(O)c1nc2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C24H27NO2.C13H10N2O3S/c1-3-5-12-19(4-2)18-27-24(26)22(17-25)23(20-13-8-6-9-14-20)21-15-10-7-11-16-21;16-19(17,18)13-14-11-8-4-5-9-12(11)15(13)10-6-2-1-3-7-10/h6-11,13-16,19H,3-5,12,18H2,1-2H3;1-9H,(H,16,17,18) |
| InChIKey | TXNHYAGDSSXYAQ-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.79 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|