C27H33NO2 — CID 163666937
2-methyldecyl 2-cyano-3,3-diphenylprop-2-enoate (PubChem CID 163666937) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 2-methyldecyl 2-cyano-3,3-diphenylprop-2-enoate.
| Compound Name | 2-methyldecyl 2-cyano-3,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 163666937 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 2-methyldecyl 2-cyano-3,3-diphenylprop-2-enoate |
| SMILES | CCCCCCCCC(C)COC(=O)C(C#N)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33NO2/c1-3-4-5-6-7-10-15-22(2)21-30-27(29)25(20-28)26(23-16-11-8-12-17-23)24-18-13-9-14-19-24/h8-9,11-14,16-19,22H,3-7,10,15,21H2,1-2H3 |
| InChIKey | IZGXLFAKYLBAMP-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|