C22H23NO2 — CID 18721051
butyl 2-cyano-3,3-bis(4-methylphenyl)prop-2-enoate (PubChem CID 18721051) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is butyl 2-cyano-3,3-bis(4-methylphenyl)prop-2-enoate.
| Compound Name | butyl 2-cyano-3,3-bis(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18721051 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | butyl 2-cyano-3,3-bis(4-methylphenyl)prop-2-enoate |
| SMILES | CCCCOC(=O)C(C#N)=C(c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H23NO2/c1-4-5-14-25-22(24)20(15-23)21(18-10-6-16(2)7-11-18)19-12-8-17(3)9-13-19/h6-13H,4-5,14H2,1-3H3 |
| InChIKey | XSUQBAPCDNETOQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|