C36H28N2O6 — CID 154121763
methyl 2-cyano-3-[4-[2-[4-(2-cyano-3-methoxy-3-oxo-1-phenylprop-1-enyl)phenoxy]ethoxy]phenyl]-3-phenylprop-2-enoate (PubChem CID 154121763) has the molecular formula C36H28N2O6 and a molecular weight of 584.63 g/mol. Its IUPAC name is methyl 2-cyano-3-[4-[2-[4-(2-cyano-3-methoxy-3-oxo-1-phenylprop-1-enyl)phenoxy]ethoxy]phenyl]-3-phenylprop-2-enoate.
| Compound Name | methyl 2-cyano-3-[4-[2-[4-(2-cyano-3-methoxy-3-oxo-1-phenylprop-1-enyl)phenoxy]ethoxy]phenyl]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 154121763 |
| Molecular Formula | C36H28N2O6 |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | methyl 2-cyano-3-[4-[2-[4-(2-cyano-3-methoxy-3-oxo-1-phenylprop-1-enyl)phenoxy]ethoxy]phenyl]-3-phenylprop-2-enoate |
| SMILES | COC(=O)C(C#N)=C(c1ccccc1)c1ccc(OCCOc2ccc(C(=C(C#N)C(=O)OC)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C36H28N2O6/c1-41-35(39)31(23-37)33(25-9-5-3-6-10-25)27-13-17-29(18-14-27)43-21-22-44-30-19-15-28(16-20-30)34(26-11-7-4-8-12-26)32(24-38)36(40)42-2/h3-20H,21-22H2,1-2H3 |
| InChIKey | BXSQRCPSLKYVLR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|