C36H32N2O7 — CID 161071056
(4-methoxyphenyl)-phenylmethanone;methyl 2-cyanoacetate;methyl (E)-2-cyano-3-(4-methoxyphenyl)-3-phenylprop-2-enoate (PubChem CID 161071056) has the molecular formula C36H32N2O7 and a molecular weight of 604.66 g/mol. Its IUPAC name is (4-methoxyphenyl)-phenylmethanone;methyl 2-cyanoacetate;methyl (E)-2-cyano-3-(4-methoxyphenyl)-3-phenylprop-2-enoate.
| Compound Name | (4-methoxyphenyl)-phenylmethanone;methyl 2-cyanoacetate;methyl (E)-2-cyano-3-(4-methoxyphenyl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 161071056 |
| Molecular Formula | C36H32N2O7 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | (4-methoxyphenyl)-phenylmethanone;methyl 2-cyanoacetate;methyl (E)-2-cyano-3-(4-methoxyphenyl)-3-phenylprop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C(\c1ccccc1)c1ccc(OC)cc1.COC(=O)CC#N.COc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15NO3.C14H12O2.C4H5NO2/c1-21-15-10-8-14(9-11-15)17(13-6-4-3-5-7-13)16(12-19)18(20)22-2;1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11;1-7-4(6)2-3-5/h3-11H,1-2H3;2-10H,1H3;2H2,1H3/b17-16+;; |
| InChIKey | UEQVAVZUPYRHLB-WXIBIURSSA-N |
| XLogP | 6.19 |
| TPSA | 135.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|