C21H17NO4 — CID 175544686
(2-cyano-3,3-diphenylprop-2-enoyl) 4-oxopentanoate (PubChem CID 175544686) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is (2-cyano-3,3-diphenylprop-2-enoyl) 4-oxopentanoate.
| Compound Name | (2-cyano-3,3-diphenylprop-2-enoyl) 4-oxopentanoate |
|---|---|
| PubChem CID | 175544686 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (2-cyano-3,3-diphenylprop-2-enoyl) 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OC(=O)C(C#N)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17NO4/c1-15(23)12-13-19(24)26-21(25)18(14-22)20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11H,12-13H2,1H3 |
| InChIKey | GJVYPBVFDZROKR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|