C22H19NO5 — CID 70540371
2-[(2-cyano-3,3-diphenylprop-2-enoyl)oxymethylidene]-4-hydroxypentanoic acid (PubChem CID 70540371) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-[(2-cyano-3,3-diphenylprop-2-enoyl)oxymethylidene]-4-hydroxypentanoic acid.
| Compound Name | 2-[(2-cyano-3,3-diphenylprop-2-enoyl)oxymethylidene]-4-hydroxypentanoic acid |
|---|---|
| PubChem CID | 70540371 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-[(2-cyano-3,3-diphenylprop-2-enoyl)oxymethylidene]-4-hydroxypentanoic acid |
| SMILES | CC(O)CC(=COC(=O)C(C#N)=C(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H19NO5/c1-15(24)12-18(21(25)26)14-28-22(27)19(13-23)20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,14-15,24H,12H2,1H3,(H,25,26) |
| InChIKey | PQNJWZZKXZUMAY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|