C38H24N2O4 — CID 23110356
[3-(2-cyano-3,3-diphenylprop-2-enoyl)oxyphenyl] 2-cyano-3,3-diphenylprop-2-enoate (PubChem CID 23110356) has the molecular formula C38H24N2O4 and a molecular weight of 572.62 g/mol. Its IUPAC name is [3-(2-cyano-3,3-diphenylprop-2-enoyl)oxyphenyl] 2-cyano-3,3-diphenylprop-2-enoate.
| Compound Name | [3-(2-cyano-3,3-diphenylprop-2-enoyl)oxyphenyl] 2-cyano-3,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 23110356 |
| Molecular Formula | C38H24N2O4 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | [3-(2-cyano-3,3-diphenylprop-2-enoyl)oxyphenyl] 2-cyano-3,3-diphenylprop-2-enoate |
| SMILES | N#CC(C(=O)Oc1cccc(OC(=O)C(C#N)=C(c2ccccc2)c2ccccc2)c1)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H24N2O4/c39-25-33(35(27-14-5-1-6-15-27)28-16-7-2-8-17-28)37(41)43-31-22-13-23-32(24-31)44-38(42)34(26-40)36(29-18-9-3-10-19-29)30-20-11-4-12-21-30/h1-24H |
| InChIKey | LZGAFUNRMOUFFI-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|