C25H26N2O2 — CID 176898545
(2-cyano-2-ethylhexyl) 2-cyano-3,3-diphenylprop-2-enoate (PubChem CID 176898545) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is (2-cyano-2-ethylhexyl) 2-cyano-3,3-diphenylprop-2-enoate.
| Compound Name | (2-cyano-2-ethylhexyl) 2-cyano-3,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 176898545 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (2-cyano-2-ethylhexyl) 2-cyano-3,3-diphenylprop-2-enoate |
| SMILES | CCCCC(C#N)(CC)COC(=O)C(C#N)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O2/c1-3-5-16-25(4-2,18-27)19-29-24(28)22(17-26)23(20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15H,3-5,16,19H2,1-2H3 |
| InChIKey | HUUUITJYQTUQNQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|