C17H13N3O2S — CID 5177083
methyl 2,6,6-tricyano-3-methylsulfanyl-5-phenylhexa-2,5-dienoate (PubChem CID 5177083) has the molecular formula C17H13N3O2S and a molecular weight of 323.38 g/mol. Its IUPAC name is methyl 2,6,6-tricyano-3-methylsulfanyl-5-phenylhexa-2,5-dienoate.
| Compound Name | methyl 2,6,6-tricyano-3-methylsulfanyl-5-phenylhexa-2,5-dienoate |
|---|---|
| PubChem CID | 5177083 |
| Molecular Formula | C17H13N3O2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | methyl 2,6,6-tricyano-3-methylsulfanyl-5-phenylhexa-2,5-dienoate |
| SMILES | COC(=O)C(C#N)=C(CC(=C(C#N)C#N)c1ccccc1)SC |
| InChI | InChI=1S/C17H13N3O2S/c1-22-17(21)15(11-20)16(23-2)8-14(13(9-18)10-19)12-6-4-3-5-7-12/h3-7H,8H2,1-2H3 |
| InChIKey | UVHDBMFOTGWGEL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 97.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|