C18H13N2NaO2S — CID 10315457
sodium benzenecarbonothioyl-[(Z)-2-cyano-3-methoxy-3-oxo-1-phenylprop-1-enyl]azanide (PubChem CID 10315457) has the molecular formula C18H13N2NaO2S and a molecular weight of 344.37 g/mol. Its IUPAC name is sodium benzenecarbonothioyl-[(Z)-2-cyano-3-methoxy-3-oxo-1-phenylprop-1-enyl]azanide.
| Compound Name | sodium benzenecarbonothioyl-[(Z)-2-cyano-3-methoxy-3-oxo-1-phenylprop-1-enyl]azanide |
|---|---|
| PubChem CID | 10315457 |
| Molecular Formula | C18H13N2NaO2S |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | sodium benzenecarbonothioyl-[(Z)-2-cyano-3-methoxy-3-oxo-1-phenylprop-1-enyl]azanide |
| SMILES | COC(=O)/C(C#N)=C(\[N-]C(=S)c1ccccc1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C18H14N2O2S.Na/c1-22-18(21)15(12-19)16(13-8-4-2-5-9-13)20-17(23)14-10-6-3-7-11-14;/h2-11H,1H3,(H,20,21,23);/q;+1/p-1 |
| InChIKey | SCIWFOUNWUSXTQ-UHFFFAOYSA-M |
| XLogP | 0.85 |
| TPSA | 64.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|