C16H19N3O2 — CID 3005089
methyl (Z)-3-anilino-2-cyano-3-piperidin-1-ylprop-2-enoate (PubChem CID 3005089) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is methyl (Z)-3-anilino-2-cyano-3-piperidin-1-ylprop-2-enoate.
| Compound Name | methyl (Z)-3-anilino-2-cyano-3-piperidin-1-ylprop-2-enoate |
|---|---|
| PubChem CID | 3005089 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | methyl (Z)-3-anilino-2-cyano-3-piperidin-1-ylprop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C(/Nc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C16H19N3O2/c1-21-16(20)14(12-17)15(19-10-6-3-7-11-19)18-13-8-4-2-5-9-13/h2,4-5,8-9,18H,3,6-7,10-11H2,1H3/b15-14- |
| InChIKey | XDXQRIITSBUTGK-PFONDFGASA-N |
| XLogP | 2.49 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|