About tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide
tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide (PubChem CID 162081451) has the molecular formula C17H26N2O3
and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide.
Molecular Properties
| Compound Name | tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide |
| PubChem CID | 162081451 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide |
| SMILES | CC(=O)Nc1ccccc1.CC(C)(C)OC(=O)N1CCCC1 |
| InChI | InChI=1S/C9H17NO2.C8H9NO/c1-9(2,3)12-8(11)10-6-4-5-7-10;1-7(10)9-8-5-3-2-4-6-8/h4-7H2,1-3H3;2-6H,1H3,(H,9,10) |
| InChIKey | ZCJXWRFUTRKNLR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide?
The IUPAC name of tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide (CID 162081451) is tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide.
What is the SMILES notation for tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide?
The canonical SMILES for tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide is CC(=O)Nc1ccccc1.CC(C)(C)OC(=O)N1CCCC1.
What is the InChIKey of tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide?
The InChIKey is ZCJXWRFUTRKNLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C8H9NO/c1-9(2,3)12-8(11)10-6-4-5-7-10;1-7(10)9-8-5-3-2-4-6-8/h4-7H2,1-3H3;2-6H,1H3,(H,9,10).
What are the key properties of tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide?
tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide has a molecular weight of 306.41 g/mol, XLogP of 3.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl pyrrolidine-1-carboxylate;N-phenylacetamide is sourced from PubChem (CID 162081451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).