About azane;tert-butyl piperidine-1-carboxylate
azane;tert-butyl piperidine-1-carboxylate (PubChem CID 134583959) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is azane;tert-butyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | azane;tert-butyl piperidine-1-carboxylate |
| PubChem CID | 134583959 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | azane;tert-butyl piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1.N |
| InChI | InChI=1S/C10H19NO2.H3N/c1-10(2,3)13-9(12)11-7-5-4-6-8-11;/h4-8H2,1-3H3;1H3 |
| InChIKey | FLOUFXOGOOCDFI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;tert-butyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;tert-butyl piperidine-1-carboxylate?
The IUPAC name of azane;tert-butyl piperidine-1-carboxylate (CID 134583959) is azane;tert-butyl piperidine-1-carboxylate.
What is the SMILES notation for azane;tert-butyl piperidine-1-carboxylate?
The canonical SMILES for azane;tert-butyl piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCCCC1.N.
What is the InChIKey of azane;tert-butyl piperidine-1-carboxylate?
The InChIKey is FLOUFXOGOOCDFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.H3N/c1-10(2,3)13-9(12)11-7-5-4-6-8-11;/h4-8H2,1-3H3;1H3.
What are the key properties of azane;tert-butyl piperidine-1-carboxylate?
azane;tert-butyl piperidine-1-carboxylate has a molecular weight of 202.30 g/mol, XLogP of 2.57, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;tert-butyl piperidine-1-carboxylate is sourced from PubChem (CID 134583959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).