C25H30N4O2 — CID 46658002
1-[(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]-N-phenylpiperidine-3-carboxamide (PubChem CID 46658002) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-[(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-[(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46658002 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1-[(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]-N-phenylpiperidine-3-carboxamide |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)N2CCCC(C(=O)Nc3ccccc3)C2)c1C |
| InChI | InChI=1S/C25H30N4O2/c1-4-12-29-18(2)14-21(19(29)3)15-22(16-26)25(31)28-13-8-9-20(17-28)24(30)27-23-10-6-5-7-11-23/h5-7,10-11,14-15,20H,4,8-9,12-13,17H2,1-3H3,(H,27,30)/b22-15+ |
| InChIKey | RGJZOWOYNMRDRZ-PXLXIMEGSA-N |
| XLogP | 4.30 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|