C25H37N5O2 — CID 134008184
4-[[(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]amino]-N-cyclohexylpiperidine-1-carboxamide (PubChem CID 134008184) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 4-[[(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]amino]-N-cyclohexylpiperidine-1-carboxamide.
| Compound Name | 4-[[(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]amino]-N-cyclohexylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 134008184 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 4-[[(E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]amino]-N-cyclohexylpiperidine-1-carboxamide |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)NC2CCN(C(=O)NC3CCCCC3)CC2)c1C |
| InChI | InChI=1S/C25H37N5O2/c1-4-12-30-18(2)15-20(19(30)3)16-21(17-26)24(31)27-23-10-13-29(14-11-23)25(32)28-22-8-6-5-7-9-22/h15-16,22-23H,4-14H2,1-3H3,(H,27,31)(H,28,32)/b21-16+ |
| InChIKey | PRIQUELVTMHQSC-LTGZKZEYSA-N |
| XLogP | 4.04 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|