C19H27N3O — CID 132971028
(E)-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-(3-methylpiperidine-1-carbonyl)prop-2-enenitrile (PubChem CID 132971028) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is (E)-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-(3-methylpiperidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-(3-methylpiperidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 132971028 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (E)-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-(3-methylpiperidine-1-carbonyl)prop-2-enenitrile |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)N2CCCC(C)C2)c1C |
| InChI | InChI=1S/C19H27N3O/c1-5-8-22-15(3)10-17(16(22)4)11-18(12-20)19(23)21-9-6-7-14(2)13-21/h10-11,14H,5-9,13H2,1-4H3/b18-11+ |
| InChIKey | NZBCNUOZZYUSBU-WOJGMQOQSA-N |
| XLogP | 3.68 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|